C13H14FN5O3 — CID 145393388
(2R,5R)-5-(2-aminopurin-9-yl)-4-ethynyl-4-fluoro-2-[(1S)-1-hydroxyethyl]oxolan-3-ol (PubChem CID 145393388) has the molecular formula C13H14FN5O3 and a molecular weight of 307.29 g/mol. Its IUPAC name is (2R,5R)-5-(2-aminopurin-9-yl)-4-ethynyl-4-fluoro-2-[(1S)-1-hydroxyethyl]oxolan-3-ol.
| Compound Name | (2R,5R)-5-(2-aminopurin-9-yl)-4-ethynyl-4-fluoro-2-[(1S)-1-hydroxyethyl]oxolan-3-ol |
|---|---|
| PubChem CID | 145393388 |
| Molecular Formula | C13H14FN5O3 |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | (2R,5R)-5-(2-aminopurin-9-yl)-4-ethynyl-4-fluoro-2-[(1S)-1-hydroxyethyl]oxolan-3-ol |
| SMILES | C#CC1(F)C(O)[C@@H]([C@H](C)O)O[C@H]1n1cnc2cnc(N)nc21 |
| InChI | InChI=1S/C13H14FN5O3/c1-3-13(14)9(21)8(6(2)20)22-11(13)19-5-17-7-4-16-12(15)18-10(7)19/h1,4-6,8-9,11,20-21H,2H3,(H2,15,16,18)/t6-,8+,9?,11+,13?/m0/s1 |
| InChIKey | NLFYVJRUZUDTPY-GTCMWOKTSA-N |
| XLogP | -0.61 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|