C11H12FN3O5 — CID 167374815
1-[(2R,3R,5R)-3-ethynyl-3-fluoro-4-hydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]-1,3,5-triazine-2,4-dione (PubChem CID 167374815) has the molecular formula C11H12FN3O5 and a molecular weight of 285.23 g/mol. Its IUPAC name is 1-[(2R,3R,5R)-3-ethynyl-3-fluoro-4-hydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]-1,3,5-triazine-2,4-dione.
| Compound Name | 1-[(2R,3R,5R)-3-ethynyl-3-fluoro-4-hydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 167374815 |
| Molecular Formula | C11H12FN3O5 |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 1-[(2R,3R,5R)-3-ethynyl-3-fluoro-4-hydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]-1,3,5-triazine-2,4-dione |
| SMILES | C#C[C@@]1(F)C(O)[C@@H]([C@H](C)O)O[C@H]1n1cnc(=O)[nH]c1=O |
| InChI | InChI=1S/C11H12FN3O5/c1-3-11(12)7(17)6(5(2)16)20-8(11)15-4-13-9(18)14-10(15)19/h1,4-8,16-17H,2H3,(H,14,18,19)/t5-,6+,7?,8+,11+/m0/s1 |
| InChIKey | FPUOBXDLNGATIG-MEWOPBGUSA-N |
| XLogP | -2.09 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|