C15H17FN4O4S — CID 163487574
9-[(2R,4S,5R)-3-(3-fluoroprop-1-ynyl)-3,4-dihydroxy-5-[(1R)-1-hydroxyethyl]oxolan-2-yl]-2-methyl-3H-purine-6-thione (PubChem CID 163487574) has the molecular formula C15H17FN4O4S and a molecular weight of 368.39 g/mol. Its IUPAC name is 9-[(2R,4S,5R)-3-(3-fluoroprop-1-ynyl)-3,4-dihydroxy-5-[(1R)-1-hydroxyethyl]oxolan-2-yl]-2-methyl-3H-purine-6-thione.
| Compound Name | 9-[(2R,4S,5R)-3-(3-fluoroprop-1-ynyl)-3,4-dihydroxy-5-[(1R)-1-hydroxyethyl]oxolan-2-yl]-2-methyl-3H-purine-6-thione |
|---|---|
| PubChem CID | 163487574 |
| Molecular Formula | C15H17FN4O4S |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 9-[(2R,4S,5R)-3-(3-fluoroprop-1-ynyl)-3,4-dihydroxy-5-[(1R)-1-hydroxyethyl]oxolan-2-yl]-2-methyl-3H-purine-6-thione |
| SMILES | Cc1nc(=S)c2ncn([C@@H]3O[C@H]([C@@H](C)O)[C@H](O)C3(O)C#CCF)c2[nH]1 |
| InChI | InChI=1S/C15H17FN4O4S/c1-7(21)10-11(22)15(23,4-3-5-16)14(24-10)20-6-17-9-12(20)18-8(2)19-13(9)25/h6-7,10-11,14,21-23H,5H2,1-2H3,(H,18,19,25)/t7-,10-,11+,14-,15?/m1/s1 |
| InChIKey | UDLOLSXLRGACRB-USLNXXMDSA-N |
| XLogP | 0.14 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|