C10H14FN2O9P — CID 155765083
[(2R,3R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-hydroxy-2-[(1R)-1-hydroxyethyl]oxolan-3-yl] dihydrogen phosphate (PubChem CID 155765083) has the molecular formula C10H14FN2O9P and a molecular weight of 356.20 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-hydroxy-2-[(1R)-1-hydroxyethyl]oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-hydroxy-2-[(1R)-1-hydroxyethyl]oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 155765083 |
| Molecular Formula | C10H14FN2O9P |
| Molecular Weight | 356.20 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | [(2R,3R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-hydroxy-2-[(1R)-1-hydroxyethyl]oxolan-3-yl] dihydrogen phosphate |
| SMILES | C[C@@H](O)[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@](O)(F)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C10H14FN2O9P/c1-4(14)6-7(22-23(18,19)20)10(11,17)8(21-6)13-3-2-5(15)12-9(13)16/h2-4,6-8,14,17H,1H3,(H,12,15,16)(H2,18,19,20)/t4-,6-,7-,8-,10-/m1/s1 |
| InChIKey | QUSCPDZVCIAKSA-VHZGFARSSA-N |
| XLogP | -2.05 |
| TPSA | 171.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.20 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|