C10H13N2O7P — CID 123393210
[3-(2,4-dioxopyrimidin-1-yl)-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl] dihydrogen phosphate (PubChem CID 123393210) has the molecular formula C10H13N2O7P and a molecular weight of 304.20 g/mol. Its IUPAC name is [3-(2,4-dioxopyrimidin-1-yl)-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl] dihydrogen phosphate.
| Compound Name | [3-(2,4-dioxopyrimidin-1-yl)-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 123393210 |
| Molecular Formula | C10H13N2O7P |
| Molecular Weight | 304.20 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | [3-(2,4-dioxopyrimidin-1-yl)-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl] dihydrogen phosphate |
| SMILES | CC1C2C(OC1n1ccc(=O)[nH]c1=O)C2OP(=O)(O)O |
| InChI | InChI=1S/C10H13N2O7P/c1-4-6-7(8(6)19-20(15,16)17)18-9(4)12-3-2-5(13)11-10(12)14/h2-4,6-9H,1H3,(H,11,13,14)(H2,15,16,17) |
| InChIKey | LUDOUCOHIIXSGC-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.20 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|