C11H13FN2O4 — CID 121325167
(2S,3R,4R,5R)-2-deuterio-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3,4-dimethyloxolane-2-carbaldehyde (PubChem CID 121325167) has the molecular formula C11H13FN2O4 and a molecular weight of 257.24 g/mol. Its IUPAC name is (2S,3R,4R,5R)-2-deuterio-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3,4-dimethyloxolane-2-carbaldehyde.
| Compound Name | (2S,3R,4R,5R)-2-deuterio-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3,4-dimethyloxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 121325167 |
| Molecular Formula | C11H13FN2O4 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | (2S,3R,4R,5R)-2-deuterio-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3,4-dimethyloxolane-2-carbaldehyde |
| SMILES | [2H][C@]1(C=O)O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(F)[C@@H]1C |
| InChI | InChI=1S/C11H13FN2O4/c1-6-7(5-15)18-9(11(6,2)12)14-4-3-8(16)13-10(14)17/h3-7,9H,1-2H3,(H,13,16,17)/t6-,7-,9-,11-/m1/s1/i7D |
| InChIKey | OWECVTHJXAOJBM-KLTDAFPWSA-N |
| XLogP | -0.00 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|