C16H27F2N2O7P — CID 142962197
1-[5-(diethoxyphosphorylmethoxy)-3,3-difluoro-4-methyloxolan-2-yl]pyrimidine-2,4-dione;ethane (PubChem CID 142962197) has the molecular formula C16H27F2N2O7P and a molecular weight of 428.37 g/mol. Its IUPAC name is 1-[5-(diethoxyphosphorylmethoxy)-3,3-difluoro-4-methyloxolan-2-yl]pyrimidine-2,4-dione;ethane.
| Compound Name | 1-[5-(diethoxyphosphorylmethoxy)-3,3-difluoro-4-methyloxolan-2-yl]pyrimidine-2,4-dione;ethane |
|---|---|
| PubChem CID | 142962197 |
| Molecular Formula | C16H27F2N2O7P |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 1-[5-(diethoxyphosphorylmethoxy)-3,3-difluoro-4-methyloxolan-2-yl]pyrimidine-2,4-dione;ethane |
| SMILES | CC.CCOP(=O)(COC1OC(n2ccc(=O)[nH]c2=O)C(F)(F)C1C)OCC |
| InChI | InChI=1S/C14H21F2N2O7P.C2H6/c1-4-23-26(21,24-5-2)8-22-11-9(3)14(15,16)12(25-11)18-7-6-10(19)17-13(18)20;1-2/h6-7,9,11-12H,4-5,8H2,1-3H3,(H,17,19,20);1-2H3 |
| InChIKey | XKOFKPGCSUIDBS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|