C14H22FN2O7P — CID 163523357
1-[(2S,5S)-5-(diethoxyphosphorylmethoxy)-4-methyloxolan-2-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 163523357) has the molecular formula C14H22FN2O7P and a molecular weight of 380.31 g/mol. Its IUPAC name is 1-[(2S,5S)-5-(diethoxyphosphorylmethoxy)-4-methyloxolan-2-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(2S,5S)-5-(diethoxyphosphorylmethoxy)-4-methyloxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 163523357 |
| Molecular Formula | C14H22FN2O7P |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 1-[(2S,5S)-5-(diethoxyphosphorylmethoxy)-4-methyloxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | CCOP(=O)(CO[C@@H]1O[C@H](n2cc(F)c(=O)[nH]c2=O)CC1C)OCC |
| InChI | InChI=1S/C14H22FN2O7P/c1-4-22-25(20,23-5-2)8-21-13-9(3)6-11(24-13)17-7-10(15)12(18)16-14(17)19/h7,9,11,13H,4-6,8H2,1-3H3,(H,16,18,19)/t9?,11-,13+/m0/s1 |
| InChIKey | DMSSDSPWVNIDOW-DALSCRRLSA-N |
| XLogP | 1.80 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|