C12H14F2IN2O6P — CID 58196180
1-[5-[[ethoxy(methyl)phosphoryl]methoxy]-3,3-difluoro-4-iodo-2H-furan-2-yl]pyrimidine-2,4-dione (PubChem CID 58196180) has the molecular formula C12H14F2IN2O6P and a molecular weight of 478.13 g/mol. Its IUPAC name is 1-[5-[[ethoxy(methyl)phosphoryl]methoxy]-3,3-difluoro-4-iodo-2H-furan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[5-[[ethoxy(methyl)phosphoryl]methoxy]-3,3-difluoro-4-iodo-2H-furan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58196180 |
| Molecular Formula | C12H14F2IN2O6P |
| Molecular Weight | 478.13 g/mol |
| Exact Mass | 477.96 |
| IUPAC Name | 1-[5-[[ethoxy(methyl)phosphoryl]methoxy]-3,3-difluoro-4-iodo-2H-furan-2-yl]pyrimidine-2,4-dione |
| SMILES | CCOP(C)(=O)COC1=C(I)C(F)(F)C(n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C12H14F2IN2O6P/c1-3-22-24(2,20)6-21-9-8(15)12(13,14)10(23-9)17-5-4-7(18)16-11(17)19/h4-5,10H,3,6H2,1-2H3,(H,16,18,19) |
| InChIKey | UKKBGGDXGRECBN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.13 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|