C22H28FN2O8P — CID 58971981
[5-(diethoxyphosphorylmethoxy)-3-(2,4-dioxopyrimidin-1-yl)-2-fluoro-2-methylcyclopentyl] benzoate (PubChem CID 58971981) has the molecular formula C22H28FN2O8P and a molecular weight of 498.44 g/mol. Its IUPAC name is [5-(diethoxyphosphorylmethoxy)-3-(2,4-dioxopyrimidin-1-yl)-2-fluoro-2-methylcyclopentyl] benzoate.
| Compound Name | [5-(diethoxyphosphorylmethoxy)-3-(2,4-dioxopyrimidin-1-yl)-2-fluoro-2-methylcyclopentyl] benzoate |
|---|---|
| PubChem CID | 58971981 |
| Molecular Formula | C22H28FN2O8P |
| Molecular Weight | 498.44 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | [5-(diethoxyphosphorylmethoxy)-3-(2,4-dioxopyrimidin-1-yl)-2-fluoro-2-methylcyclopentyl] benzoate |
| SMILES | CCOP(=O)(COC1CC(n2ccc(=O)[nH]c2=O)C(C)(F)C1OC(=O)c1ccccc1)OCC |
| InChI | InChI=1S/C22H28FN2O8P/c1-4-31-34(29,32-5-2)14-30-16-13-17(25-12-11-18(26)24-21(25)28)22(3,23)19(16)33-20(27)15-9-7-6-8-10-15/h6-12,16-17,19H,4-5,13-14H2,1-3H3,(H,24,26,28) |
| InChIKey | JILGOBPDQNKWFU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|