C13H19F2N2O7P — CID 142962163
1-[5-(diethoxyphosphanylmethoxy)-3,3-difluoro-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 142962163) has the molecular formula C13H19F2N2O7P and a molecular weight of 384.27 g/mol. Its IUPAC name is 1-[5-(diethoxyphosphanylmethoxy)-3,3-difluoro-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[5-(diethoxyphosphanylmethoxy)-3,3-difluoro-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142962163 |
| Molecular Formula | C13H19F2N2O7P |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 1-[5-(diethoxyphosphanylmethoxy)-3,3-difluoro-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CCOP(COC1OC(n2ccc(=O)[nH]c2=O)C(F)(F)C1O)OCC |
| InChI | InChI=1S/C13H19F2N2O7P/c1-3-22-25(23-4-2)7-21-10-9(19)13(14,15)11(24-10)17-6-5-8(18)16-12(17)20/h5-6,9-11,19H,3-4,7H2,1-2H3,(H,16,18,20) |
| InChIKey | DSINYCBQIBGWNJ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|