C24H29N3O3SSi — CID 22881112
4-amino-1-[(2S,5R)-2-[[tert-butyl(diphenyl)silyl]-hydroxymethyl]-1,3-oxathiolan-5-yl]pyrimidin-2-one (PubChem CID 22881112) has the molecular formula C24H29N3O3SSi and a molecular weight of 467.67 g/mol. Its IUPAC name is 4-amino-1-[(2S,5R)-2-[[tert-butyl(diphenyl)silyl]-hydroxymethyl]-1,3-oxathiolan-5-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2S,5R)-2-[[tert-butyl(diphenyl)silyl]-hydroxymethyl]-1,3-oxathiolan-5-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 22881112 |
| Molecular Formula | C24H29N3O3SSi |
| Molecular Weight | 467.67 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 4-amino-1-[(2S,5R)-2-[[tert-butyl(diphenyl)silyl]-hydroxymethyl]-1,3-oxathiolan-5-yl]pyrimidin-2-one |
| SMILES | CC(C)(C)[Si](c1ccccc1)(c1ccccc1)C(O)[C@H]1O[C@@H](n2ccc(N)nc2=O)CS1 |
| InChI | InChI=1S/C24H29N3O3SSi/c1-24(2,3)32(17-10-6-4-7-11-17,18-12-8-5-9-13-18)21(28)22-30-20(16-31-22)27-15-14-19(25)26-23(27)29/h4-15,20-22,28H,16H2,1-3H3,(H2,25,26,29)/t20-,21?,22+/m1/s1 |
| InChIKey | UVKSJARXCPUYSU-QFMSAKRMSA-N |
| XLogP | 2.38 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.67 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|