C14H19ClFN3O5 — CID 123364261
2-[[5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-methylpropanal (PubChem CID 123364261) has the molecular formula C14H19ClFN3O5 and a molecular weight of 363.77 g/mol. Its IUPAC name is 2-[[5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-methylpropanal.
| Compound Name | 2-[[5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-methylpropanal |
|---|---|
| PubChem CID | 123364261 |
| Molecular Formula | C14H19ClFN3O5 |
| Molecular Weight | 363.77 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 2-[[5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-methylpropanal |
| SMILES | CC(C)(C=O)OCC1(CCl)OC(n2ccc(N)nc2=O)C(F)C1O |
| InChI | InChI=1S/C14H19ClFN3O5/c1-13(2,6-20)23-7-14(5-15)10(21)9(16)11(24-14)19-4-3-8(17)18-12(19)22/h3-4,6,9-11,21H,5,7H2,1-2H3,(H2,17,18,22) |
| InChIKey | RGMNVXLAOPITRW-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.77 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|