C13H20ClFN3O6P — CID 123684767
4-amino-1-[5-(chloromethyl)-5-(2-dimethoxyphosphorylethyl)-3-fluoro-4-hydroxyoxolan-2-yl]pyrimidin-2-one (PubChem CID 123684767) has the molecular formula C13H20ClFN3O6P and a molecular weight of 399.74 g/mol. Its IUPAC name is 4-amino-1-[5-(chloromethyl)-5-(2-dimethoxyphosphorylethyl)-3-fluoro-4-hydroxyoxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[5-(chloromethyl)-5-(2-dimethoxyphosphorylethyl)-3-fluoro-4-hydroxyoxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 123684767 |
| Molecular Formula | C13H20ClFN3O6P |
| Molecular Weight | 399.74 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 4-amino-1-[5-(chloromethyl)-5-(2-dimethoxyphosphorylethyl)-3-fluoro-4-hydroxyoxolan-2-yl]pyrimidin-2-one |
| SMILES | COP(=O)(CCC1(CCl)OC(n2ccc(N)nc2=O)C(F)C1O)OC |
| InChI | InChI=1S/C13H20ClFN3O6P/c1-22-25(21,23-2)6-4-13(7-14)10(19)9(15)11(24-13)18-5-3-8(16)17-12(18)20/h3,5,9-11,19H,4,6-7H2,1-2H3,(H2,16,17,20) |
| InChIKey | MSVXRSZXSRXVOE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.74 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|