C12H17ClF2N3O12P3 — CID 153247164
[(Z)-2-[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]-1-fluoroprop-1-enyl]-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid (PubChem CID 153247164) has the molecular formula C12H17ClF2N3O12P3 and a molecular weight of 561.65 g/mol. Its IUPAC name is [(Z)-2-[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]-1-fluoroprop-1-enyl]-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid.
| Compound Name | [(Z)-2-[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]-1-fluoroprop-1-enyl]-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid |
|---|---|
| PubChem CID | 153247164 |
| Molecular Formula | C12H17ClF2N3O12P3 |
| Molecular Weight | 561.65 g/mol |
| Exact Mass | 560.97 |
| IUPAC Name | [(Z)-2-[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]-1-fluoroprop-1-enyl]-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid |
| SMILES | C/C(=C(\F)P(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@]1(CCl)O[C@@H](n2ccc(N)nc2=O)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C12H17ClF2N3O12P3/c1-5(9(15)31(21,22)29-33(26,27)30-32(23,24)25)12(4-13)8(19)7(14)10(28-12)18-3-2-6(16)17-11(18)20/h2-3,7-8,10,19H,4H2,1H3,(H,21,22)(H,26,27)(H2,16,17,20)(H2,23,24,25)/b9-5-/t7-,8+,10-,12-/m1/s1 |
| InChIKey | WSPHIKOYGQZOGV-BSEBSSDSSA-N |
| XLogP | 0.64 |
| TPSA | 240.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.65 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|