C12H20ClFN3O12P3S — CID 123516656
[2-[5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]-1-sulfanylpropyl]-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid (PubChem CID 123516656) has the molecular formula C12H20ClFN3O12P3S and a molecular weight of 577.74 g/mol. Its IUPAC name is [2-[5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]-1-sulfanylpropyl]-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid.
| Compound Name | [2-[5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]-1-sulfanylpropyl]-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid |
|---|---|
| PubChem CID | 123516656 |
| Molecular Formula | C12H20ClFN3O12P3S |
| Molecular Weight | 577.74 g/mol |
| Exact Mass | 576.97 |
| IUPAC Name | [2-[5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]-1-sulfanylpropyl]-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid |
| SMILES | CC(C(S)P(=O)(O)OP(=O)(O)OP(=O)(O)O)C1(CCl)OC(n2ccc(N)nc2=O)C(F)C1O |
| InChI | InChI=1S/C12H20ClFN3O12P3S/c1-5(10(33)30(20,21)28-32(25,26)29-31(22,23)24)12(4-13)8(18)7(14)9(27-12)17-3-2-6(15)16-11(17)19/h2-3,5,7-10,18,33H,4H2,1H3,(H,20,21)(H,25,26)(H2,15,16,19)(H2,22,23,24) |
| InChIKey | YVLPXYOGQQOQHS-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 240.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.74 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|