C12H19FN3O13P3 — CID 71761527
[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-cyclopropyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 71761527) has the molecular formula C12H19FN3O13P3 and a molecular weight of 525.21 g/mol. Its IUPAC name is [[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-cyclopropyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-cyclopropyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 71761527 |
| Molecular Formula | C12H19FN3O13P3 |
| Molecular Weight | 525.21 g/mol |
| Exact Mass | 525.01 |
| IUPAC Name | [[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-cyclopropyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1ccn([C@@H]2O[C@@](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)(C3CC3)[C@@H](O)[C@H]2F)c(=O)n1 |
| InChI | InChI=1S/C12H19FN3O13P3/c13-8-9(17)12(6-1-2-6,27-10(8)16-4-3-7(14)15-11(16)18)5-26-31(22,23)29-32(24,25)28-30(19,20)21/h3-4,6,8-10,17H,1-2,5H2,(H,22,23)(H,24,25)(H2,14,15,18)(H2,19,20,21)/t8-,9+,10-,12+/m1/s1 |
| InChIKey | OAQBXROWDHKRBV-KLBPJQLPSA-N |
| XLogP | -0.45 |
| TPSA | 250.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.21 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|