C12H20FN4O12P3 — CID 144767243
[[(2R,3R,4R,5R)-2-(aminomethyl)-5-(4-amino-2-oxopyrimidin-1-yl)-3-ethenyl-4-fluorooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 144767243) has the molecular formula C12H20FN4O12P3 and a molecular weight of 524.23 g/mol. Its IUPAC name is [[(2R,3R,4R,5R)-2-(aminomethyl)-5-(4-amino-2-oxopyrimidin-1-yl)-3-ethenyl-4-fluorooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R,5R)-2-(aminomethyl)-5-(4-amino-2-oxopyrimidin-1-yl)-3-ethenyl-4-fluorooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 144767243 |
| Molecular Formula | C12H20FN4O12P3 |
| Molecular Weight | 524.23 g/mol |
| Exact Mass | 524.03 |
| IUPAC Name | [[(2R,3R,4R,5R)-2-(aminomethyl)-5-(4-amino-2-oxopyrimidin-1-yl)-3-ethenyl-4-fluorooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C=C[C@H]1[C@@H](F)[C@H](n2ccc(N)nc2=O)O[C@]1(CN)COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C12H20FN4O12P3/c1-2-7-9(13)10(17-4-3-8(15)16-11(17)18)27-12(7,5-14)6-26-31(22,23)29-32(24,25)28-30(19,20)21/h2-4,7,9-10H,1,5-6,14H2,(H,22,23)(H,24,25)(H2,15,16,18)(H2,19,20,21)/t7-,9+,10+,12+/m0/s1 |
| InChIKey | LFXLKXUDHUAZFM-CKIYVRPFSA-N |
| XLogP | -0.46 |
| TPSA | 255.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.23 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|