C15H21ClF2N3O6P — CID 123491370
4-amino-1-[(2R,3R,4R,5R)-5-(chloromethyl)-5-(2-diethoxyphosphoryl-2-fluoroethenyl)-3-fluoro-4-hydroxyoxolan-2-yl]pyrimidin-2-one (PubChem CID 123491370) has the molecular formula C15H21ClF2N3O6P and a molecular weight of 443.77 g/mol. Its IUPAC name is 4-amino-1-[(2R,3R,4R,5R)-5-(chloromethyl)-5-(2-diethoxyphosphoryl-2-fluoroethenyl)-3-fluoro-4-hydroxyoxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3R,4R,5R)-5-(chloromethyl)-5-(2-diethoxyphosphoryl-2-fluoroethenyl)-3-fluoro-4-hydroxyoxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 123491370 |
| Molecular Formula | C15H21ClF2N3O6P |
| Molecular Weight | 443.77 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 4-amino-1-[(2R,3R,4R,5R)-5-(chloromethyl)-5-(2-diethoxyphosphoryl-2-fluoroethenyl)-3-fluoro-4-hydroxyoxolan-2-yl]pyrimidin-2-one |
| SMILES | CCOP(=O)(OCC)C(F)=C[C@@]1(CCl)O[C@@H](n2ccc(N)nc2=O)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C15H21ClF2N3O6P/c1-3-25-28(24,26-4-2)9(17)7-15(8-16)12(22)11(18)13(27-15)21-6-5-10(19)20-14(21)23/h5-7,11-13,22H,3-4,8H2,1-2H3,(H2,19,20,23)/t11-,12+,13-,15+/m1/s1 |
| InChIKey | JMCWAXGGBJYNHF-COMQUAJESA-N |
| XLogP | 2.11 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.77 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|