C16H23ClF2N3O6P — CID 155070121
1-[(2R,3R,4R,5R)-5-(chloromethyl)-5-[(Z)-2-diethoxyphosphoryl-2-fluoroethenyl]-3-fluoro-4-hydroxyoxolan-2-yl]-4-(methylamino)pyrimidin-2-one (PubChem CID 155070121) has the molecular formula C16H23ClF2N3O6P and a molecular weight of 457.80 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-5-(chloromethyl)-5-[(Z)-2-diethoxyphosphoryl-2-fluoroethenyl]-3-fluoro-4-hydroxyoxolan-2-yl]-4-(methylamino)pyrimidin-2-one.
| Compound Name | 1-[(2R,3R,4R,5R)-5-(chloromethyl)-5-[(Z)-2-diethoxyphosphoryl-2-fluoroethenyl]-3-fluoro-4-hydroxyoxolan-2-yl]-4-(methylamino)pyrimidin-2-one |
|---|---|
| PubChem CID | 155070121 |
| Molecular Formula | C16H23ClF2N3O6P |
| Molecular Weight | 457.80 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-5-(chloromethyl)-5-[(Z)-2-diethoxyphosphoryl-2-fluoroethenyl]-3-fluoro-4-hydroxyoxolan-2-yl]-4-(methylamino)pyrimidin-2-one |
| SMILES | CCOP(=O)(OCC)/C(F)=C\[C@@]1(CCl)O[C@@H](n2ccc(NC)nc2=O)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C16H23ClF2N3O6P/c1-4-26-29(25,27-5-2)10(18)8-16(9-17)13(23)12(19)14(28-16)22-7-6-11(20-3)21-15(22)24/h6-8,12-14,23H,4-5,9H2,1-3H3,(H,20,21,24)/b10-8-/t12-,13+,14-,16+/m1/s1 |
| InChIKey | GVLPDEFZWLVGQN-SLZUTIBJSA-N |
| XLogP | 2.57 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.80 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|