C10H14FN3O4 — CID 170016723
[4-hydroxy-5-[4-(methylamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl hypofluorite (PubChem CID 170016723) has the molecular formula C10H14FN3O4 and a molecular weight of 259.24 g/mol. Its IUPAC name is [4-hydroxy-5-[4-(methylamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl hypofluorite.
| Compound Name | [4-hydroxy-5-[4-(methylamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl hypofluorite |
|---|---|
| PubChem CID | 170016723 |
| Molecular Formula | C10H14FN3O4 |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | [4-hydroxy-5-[4-(methylamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl hypofluorite |
| SMILES | CNc1ccn(C2OC(COF)CC2O)c(=O)n1 |
| InChI | InChI=1S/C10H14FN3O4/c1-12-8-2-3-14(10(16)13-8)9-7(15)4-6(18-9)5-17-11/h2-3,6-7,9,15H,4-5H2,1H3,(H,12,13,16) |
| InChIKey | BVKPTVRHAGLCCN-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |