C13H19N3O5 — CID 59965063
2-[(2R,5R)-3,4-dimethoxy-5-[4-(methylamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]acetaldehyde (PubChem CID 59965063) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-[(2R,5R)-3,4-dimethoxy-5-[4-(methylamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]acetaldehyde.
| Compound Name | 2-[(2R,5R)-3,4-dimethoxy-5-[4-(methylamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 59965063 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-[(2R,5R)-3,4-dimethoxy-5-[4-(methylamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]acetaldehyde |
| SMILES | CNc1ccn([C@@H]2O[C@H](CC=O)C(OC)C2OC)c(=O)n1 |
| InChI | InChI=1S/C13H19N3O5/c1-14-9-4-6-16(13(18)15-9)12-11(20-3)10(19-2)8(21-12)5-7-17/h4,6-8,10-12H,5H2,1-3H3,(H,14,15,18)/t8-,10?,11?,12-/m1/s1 |
| InChIKey | CQLSCZPZYRDZDJ-OZOYIQBDSA-N |
| XLogP | -0.20 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|