C21H34N3O9PS — CID 174084633
butyl 2-[[(5R)-5-(4-amino-2-oxopyrimidin-1-yl)thiolan-2-yl]methoxy-(2-butoxy-2-oxoethoxy)phosphoryl]oxyacetate (PubChem CID 174084633) has the molecular formula C21H34N3O9PS and a molecular weight of 535.56 g/mol. Its IUPAC name is butyl 2-[[(5R)-5-(4-amino-2-oxopyrimidin-1-yl)thiolan-2-yl]methoxy-(2-butoxy-2-oxoethoxy)phosphoryl]oxyacetate.
| Compound Name | butyl 2-[[(5R)-5-(4-amino-2-oxopyrimidin-1-yl)thiolan-2-yl]methoxy-(2-butoxy-2-oxoethoxy)phosphoryl]oxyacetate |
|---|---|
| PubChem CID | 174084633 |
| Molecular Formula | C21H34N3O9PS |
| Molecular Weight | 535.56 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | butyl 2-[[(5R)-5-(4-amino-2-oxopyrimidin-1-yl)thiolan-2-yl]methoxy-(2-butoxy-2-oxoethoxy)phosphoryl]oxyacetate |
| SMILES | CCCCOC(=O)COP(=O)(OCC(=O)OCCCC)OCC1CC[C@H](n2ccc(N)nc2=O)S1 |
| InChI | InChI=1S/C21H34N3O9PS/c1-3-5-11-29-19(25)14-32-34(28,33-15-20(26)30-12-6-4-2)31-13-16-7-8-18(35-16)24-10-9-17(22)23-21(24)27/h9-10,16,18H,3-8,11-15H2,1-2H3,(H2,22,23,27)/t16?,18-/m1/s1 |
| InChIKey | JIUICFKDVMLRQQ-UHUGOGIASA-N |
| XLogP | 3.06 |
| TPSA | 158.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|