C19H32N5O4P — CID 143737136
butyl 2-[[[(E)-2-[5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]ethenyl]-(propan-2-ylamino)phosphanyl]amino]acetate (PubChem CID 143737136) has the molecular formula C19H32N5O4P and a molecular weight of 425.47 g/mol. Its IUPAC name is butyl 2-[[[(E)-2-[5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]ethenyl]-(propan-2-ylamino)phosphanyl]amino]acetate.
| Compound Name | butyl 2-[[[(E)-2-[5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]ethenyl]-(propan-2-ylamino)phosphanyl]amino]acetate |
|---|---|
| PubChem CID | 143737136 |
| Molecular Formula | C19H32N5O4P |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | butyl 2-[[[(E)-2-[5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]ethenyl]-(propan-2-ylamino)phosphanyl]amino]acetate |
| SMILES | CCCCOC(=O)CNP(/C=C/C1CCC(n2ccc(N)nc2=O)O1)NC(C)C |
| InChI | InChI=1S/C19H32N5O4P/c1-4-5-11-27-18(25)13-21-29(23-14(2)3)12-9-15-6-7-17(28-15)24-10-8-16(20)22-19(24)26/h8-10,12,14-15,17,21,23H,4-7,11,13H2,1-3H3,(H2,20,22,26)/b12-9+ |
| InChIKey | DXVROJLSQWMSRO-FMIVXFBMSA-N |
| XLogP | 2.26 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|