About 4-amino-1-[(2R,5S)-5-[2-[di(propan-2-yl)amino]acetyl]oxolan-2-yl]pyrimidin-2-one
4-amino-1-[(2R,5S)-5-[2-[di(propan-2-yl)amino]acetyl]oxolan-2-yl]pyrimidin-2-one (PubChem CID 54466915) has the molecular formula C16H26N4O3
and a molecular weight of 322.41 g/mol. Its IUPAC name is 4-amino-1-[(2R,5S)-5-[2-[di(propan-2-yl)amino]acetyl]oxolan-2-yl]pyrimidin-2-one.
Molecular Properties
| Compound Name | 4-amino-1-[(2R,5S)-5-[2-[di(propan-2-yl)amino]acetyl]oxolan-2-yl]pyrimidin-2-one |
| PubChem CID | 54466915 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 4-amino-1-[(2R,5S)-5-[2-[di(propan-2-yl)amino]acetyl]oxolan-2-yl]pyrimidin-2-one |
| SMILES | CC(C)N(CC(=O)[C@@H]1CC[C@H](n2ccc(N)nc2=O)O1)C(C)C |
| InChI | InChI=1S/C16H26N4O3/c1-10(2)20(11(3)4)9-12(21)13-5-6-15(23-13)19-8-7-14(17)18-16(19)22/h7-8,10-11,13,15H,5-6,9H2,1-4H3,(H2,17,18,22)/t13-,15+/m0/s1 |
| InChIKey | XFNMBUKXHLSXLE-DZGCQCFKSA-N |
| XLogP | 1.19 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-amino-1-[(2R,5S)-5-[2-[di(propan-2-yl)amino]acetyl]oxolan-2-yl]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-[(2R,5S)-5-[2-[di(propan-2-yl)amino]acetyl]oxolan-2-yl]pyrimidin-2-one?
The IUPAC name of 4-amino-1-[(2R,5S)-5-[2-[di(propan-2-yl)amino]acetyl]oxolan-2-yl]pyrimidin-2-one (CID 54466915) is 4-amino-1-[(2R,5S)-5-[2-[di(propan-2-yl)amino]acetyl]oxolan-2-yl]pyrimidin-2-one.
What is the SMILES notation for 4-amino-1-[(2R,5S)-5-[2-[di(propan-2-yl)amino]acetyl]oxolan-2-yl]pyrimidin-2-one?
The canonical SMILES for 4-amino-1-[(2R,5S)-5-[2-[di(propan-2-yl)amino]acetyl]oxolan-2-yl]pyrimidin-2-one is CC(C)N(CC(=O)[C@@H]1CC[C@H](n2ccc(N)nc2=O)O1)C(C)C.
What is the InChIKey of 4-amino-1-[(2R,5S)-5-[2-[di(propan-2-yl)amino]acetyl]oxolan-2-yl]pyrimidin-2-one?
The InChIKey is XFNMBUKXHLSXLE-DZGCQCFKSA-N. The full InChI is InChI=1S/C16H26N4O3/c1-10(2)20(11(3)4)9-12(21)13-5-6-15(23-13)19-8-7-14(17)18-16(19)22/h7-8,10-11,13,15H,5-6,9H2,1-4H3,(H2,17,18,22)/t13-,15+/m0/s1.
What are the key properties of 4-amino-1-[(2R,5S)-5-[2-[di(propan-2-yl)amino]acetyl]oxolan-2-yl]pyrimidin-2-one?
4-amino-1-[(2R,5S)-5-[2-[di(propan-2-yl)amino]acetyl]oxolan-2-yl]pyrimidin-2-one has a molecular weight of 322.41 g/mol, XLogP of 1.19, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-[(2R,5S)-5-[2-[di(propan-2-yl)amino]acetyl]oxolan-2-yl]pyrimidin-2-one is sourced from PubChem (CID 54466915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).