C22H43N3O3SSi2 — CID 10254825
4-amino-1-[(4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]thiolan-2-yl]pyrimidin-2-one (PubChem CID 10254825) has the molecular formula C22H43N3O3SSi2 and a molecular weight of 485.84 g/mol. Its IUPAC name is 4-amino-1-[(4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]thiolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]thiolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 10254825 |
| Molecular Formula | C22H43N3O3SSi2 |
| Molecular Weight | 485.84 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | 4-amino-1-[(4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]thiolan-2-yl]pyrimidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1CC(n2ccc(N)nc2=O)S[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H43N3O3SSi2/c1-21(2,3)30(7,8)27-14-16-13-19(25-12-11-18(23)24-20(25)26)29-17(16)15-28-31(9,10)22(4,5)6/h11-12,16-17,19H,13-15H2,1-10H3,(H2,23,24,26)/t16-,17-,19?/m1/s1 |
| InChIKey | QALLIOHGEHHTRF-QNZPCDNOSA-N |
| XLogP | 5.49 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.84 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|