C15H27N3O4Si — CID 102225749
4-amino-1-[(2S,4R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-1,3-dioxolan-4-yl]pyrimidin-2-one (PubChem CID 102225749) has the molecular formula C15H27N3O4Si and a molecular weight of 341.48 g/mol. Its IUPAC name is 4-amino-1-[(2S,4R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-1,3-dioxolan-4-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2S,4R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-1,3-dioxolan-4-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 102225749 |
| Molecular Formula | C15H27N3O4Si |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 4-amino-1-[(2S,4R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-1,3-dioxolan-4-yl]pyrimidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1OC[C@](C)(n2ccc(N)nc2=O)O1 |
| InChI | InChI=1S/C15H27N3O4Si/c1-14(2,3)23(5,6)21-9-12-20-10-15(4,22-12)18-8-7-11(16)17-13(18)19/h7-8,12H,9-10H2,1-6H3,(H2,16,17,19)/t12-,15+/m0/s1 |
| InChIKey | SYIQHIOYZBLSTN-SWLSCSKDSA-N |
| XLogP | 1.89 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|