C18H28BrF2N3O5Si — CID 88580032
[(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4-difluorooxolan-3-yl] 2-bromopropanoate (PubChem CID 88580032) has the molecular formula C18H28BrF2N3O5Si and a molecular weight of 512.42 g/mol. Its IUPAC name is [(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4-difluorooxolan-3-yl] 2-bromopropanoate.
| Compound Name | [(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4-difluorooxolan-3-yl] 2-bromopropanoate |
|---|---|
| PubChem CID | 88580032 |
| Molecular Formula | C18H28BrF2N3O5Si |
| Molecular Weight | 512.42 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | [(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4-difluorooxolan-3-yl] 2-bromopropanoate |
| SMILES | CC(Br)C(=O)OC1[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](n2ccc(N)nc2=O)C1(F)F |
| InChI | InChI=1S/C18H28BrF2N3O5Si/c1-10(19)14(25)29-13-11(9-27-30(5,6)17(2,3)4)28-15(18(13,20)21)24-8-7-12(22)23-16(24)26/h7-8,10-11,13,15H,9H2,1-6H3,(H2,22,23,26)/t10?,11-,13?,15-/m1/s1 |
| InChIKey | YCKAVLZSBFYSRJ-WGJVFSFXSA-N |
| XLogP | 3.08 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|