C33H40ClN4O7PSi — CID 10794817
prop-2-enyl N-[1-[(2R,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[chloro(2-cyanoethoxy)phosphanyl]oxyoxolan-2-yl]-5-methyl-2-oxopyrimidin-4-yl]carbamate (PubChem CID 10794817) has the molecular formula C33H40ClN4O7PSi and a molecular weight of 699.22 g/mol. Its IUPAC name is prop-2-enyl N-[1-[(2R,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[chloro(2-cyanoethoxy)phosphanyl]oxyoxolan-2-yl]-5-methyl-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | prop-2-enyl N-[1-[(2R,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[chloro(2-cyanoethoxy)phosphanyl]oxyoxolan-2-yl]-5-methyl-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 10794817 |
| Molecular Formula | C33H40ClN4O7PSi |
| Molecular Weight | 699.22 g/mol |
| Exact Mass | 698.21 |
| IUPAC Name | prop-2-enyl N-[1-[(2R,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[chloro(2-cyanoethoxy)phosphanyl]oxyoxolan-2-yl]-5-methyl-2-oxopyrimidin-4-yl]carbamate |
| SMILES | C=CCOC(=O)Nc1nc(=O)n([C@H]2C[C@H](OP(Cl)OCCC#N)[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O2)cc1C |
| InChI | InChI=1S/C33H40ClN4O7PSi/c1-6-19-41-32(40)37-30-24(2)22-38(31(39)36-30)29-21-27(45-46(34)42-20-13-18-35)28(44-29)23-43-47(33(3,4)5,25-14-9-7-10-15-25)26-16-11-8-12-17-26/h6-12,14-17,22,27-29H,1,13,19-21,23H2,2-5H3,(H,36,37,39,40)/t27-,28+,29+,46?/m0/s1 |
| InChIKey | AITJIDDRSGMOEU-CISIXPNGSA-N |
| XLogP | 5.93 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.22 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|