C29H42FN3O5Si2 — CID 140877196
N-[1-[(1S,2S,4R,6R,8R)-2-[tert-butyl(dimethyl)silyl]oxy-4-fluoro-6-trimethylsilyloxy-9-oxatricyclo[4.3.0.02,4]nonan-8-yl]-5-methyl-2-oxopyrimidin-4-yl]benzamide (PubChem CID 140877196) has the molecular formula C29H42FN3O5Si2 and a molecular weight of 587.84 g/mol. Its IUPAC name is N-[1-[(1S,2S,4R,6R,8R)-2-[tert-butyl(dimethyl)silyl]oxy-4-fluoro-6-trimethylsilyloxy-9-oxatricyclo[4.3.0.02,4]nonan-8-yl]-5-methyl-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(1S,2S,4R,6R,8R)-2-[tert-butyl(dimethyl)silyl]oxy-4-fluoro-6-trimethylsilyloxy-9-oxatricyclo[4.3.0.02,4]nonan-8-yl]-5-methyl-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 140877196 |
| Molecular Formula | C29H42FN3O5Si2 |
| Molecular Weight | 587.84 g/mol |
| Exact Mass | 587.26 |
| IUPAC Name | N-[1-[(1S,2S,4R,6R,8R)-2-[tert-butyl(dimethyl)silyl]oxy-4-fluoro-6-trimethylsilyloxy-9-oxatricyclo[4.3.0.02,4]nonan-8-yl]-5-methyl-2-oxopyrimidin-4-yl]benzamide |
| SMILES | Cc1cn([C@H]2C[C@@]3(O[Si](C)(C)C)C[C@]4(F)C[C@]4(O[Si](C)(C)C(C)(C)C)[C@H]3O2)c(=O)nc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H42FN3O5Si2/c1-19-16-33(25(35)32-22(19)31-23(34)20-13-11-10-12-14-20)21-15-27(37-39(5,6)7)17-28(30)18-29(28,24(27)36-21)38-40(8,9)26(2,3)4/h10-14,16,21,24H,15,17-18H2,1-9H3,(H,31,32,34,35)/t21-,24+,27-,28+,29+/m1/s1 |
| InChIKey | JDDMQTDFTYVWRO-YGSDXLCUSA-N |
| XLogP | 5.96 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.84 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|