C22H38N2O6Si — CID 163924720
1-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(propan-2-yloxymethyl)oxolan-2-yl]-5-(prop-2-enoxymethyl)pyrimidine-2,4-dione (PubChem CID 163924720) has the molecular formula C22H38N2O6Si and a molecular weight of 454.64 g/mol. Its IUPAC name is 1-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(propan-2-yloxymethyl)oxolan-2-yl]-5-(prop-2-enoxymethyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(propan-2-yloxymethyl)oxolan-2-yl]-5-(prop-2-enoxymethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 163924720 |
| Molecular Formula | C22H38N2O6Si |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 1-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(propan-2-yloxymethyl)oxolan-2-yl]-5-(prop-2-enoxymethyl)pyrimidine-2,4-dione |
| SMILES | C=CCOCc1cn([C@H]2CC(O[Si](C)(C)C(C)(C)C)[C@@H](COC(C)C)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H38N2O6Si/c1-9-10-27-13-16-12-24(21(26)23-20(16)25)19-11-17(18(29-19)14-28-15(2)3)30-31(7,8)22(4,5)6/h9,12,15,17-19H,1,10-11,13-14H2,2-8H3,(H,23,25,26)/t17?,18-,19-/m1/s1 |
| InChIKey | RDLJPPCEELZNMG-OMKBGSMGSA-N |
| XLogP | 3.34 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|