C36H34N3O6PSe — CID 10078535
1-[(2R,4S,5R)-4-[anilino(methyl)phosphinoselenoyl]oxy-5-[(9-phenylxanthen-9-yl)oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 10078535) has the molecular formula C36H34N3O6PSe and a molecular weight of 714.62 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-[anilino(methyl)phosphinoselenoyl]oxy-5-[(9-phenylxanthen-9-yl)oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-[anilino(methyl)phosphinoselenoyl]oxy-5-[(9-phenylxanthen-9-yl)oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10078535 |
| Molecular Formula | C36H34N3O6PSe |
| Molecular Weight | 714.62 g/mol |
| Exact Mass | 715.14 |
| IUPAC Name | 1-[(2R,4S,5R)-4-[anilino(methyl)phosphinoselenoyl]oxy-5-[(9-phenylxanthen-9-yl)oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](OP(C)(=[Se])Nc3ccccc3)[C@@H](COC3(c4ccccc4)c4ccccc4Oc4ccccc43)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C36H34N3O6PSe/c1-24-22-39(35(41)37-34(24)40)33-21-31(45-46(2,47)38-26-15-7-4-8-16-26)32(44-33)23-42-36(25-13-5-3-6-14-25)27-17-9-11-19-29(27)43-30-20-12-10-18-28(30)36/h3-20,22,31-33H,21,23H2,1-2H3,(H,38,47)(H,37,40,41)/t31-,32+,33+,46?/m0/s1 |
| InChIKey | ZENBCDNNJVDINN-YEAPKVKFSA-N |
| XLogP | 6.31 |
| TPSA | 103.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.62 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|