C18H31N5O4Si — CID 14311018
1-[4-azido-5-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 14311018) has the molecular formula C18H31N5O4Si and a molecular weight of 409.56 g/mol. Its IUPAC name is 1-[4-azido-5-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[4-azido-5-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 14311018 |
| Molecular Formula | C18H31N5O4Si |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 1-[4-azido-5-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(C2CC(N=[N+]=[N-])C(CO[Si](C)(C)C(C)(C)C(C)C)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H31N5O4Si/c1-11(2)18(4,5)28(6,7)26-10-14-13(21-22-19)8-15(27-14)23-9-12(3)16(24)20-17(23)25/h9,11,13-15H,8,10H2,1-7H3,(H,20,24,25) |
| InChIKey | ZXUZLQLMSPWYNR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|