C17H25N5O7 — CID 155666510
5-[[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]-5-hydroxy-3,3-dimethylpentanoic acid (PubChem CID 155666510) has the molecular formula C17H25N5O7 and a molecular weight of 411.42 g/mol. Its IUPAC name is 5-[[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]-5-hydroxy-3,3-dimethylpentanoic acid.
| Compound Name | 5-[[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]-5-hydroxy-3,3-dimethylpentanoic acid |
|---|---|
| PubChem CID | 155666510 |
| Molecular Formula | C17H25N5O7 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 5-[[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]-5-hydroxy-3,3-dimethylpentanoic acid |
| SMILES | Cc1cn(C2CC(N=[N+]=[N-])C(COC(O)CC(C)(C)CC(=O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H25N5O7/c1-9-7-22(16(27)19-15(9)26)12-4-10(20-21-18)11(29-12)8-28-14(25)6-17(2,3)5-13(23)24/h7,10-12,14,25H,4-6,8H2,1-3H3,(H,23,24)(H,19,26,27) |
| InChIKey | BUKKTFREYBSWQK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 179.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|