C14H21N5O6P+ — CID 11234580
[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-[(2-methylpropan-2-yl)oxy]-oxophosphanium (PubChem CID 11234580) has the molecular formula C14H21N5O6P+ and a molecular weight of 386.33 g/mol. Its IUPAC name is [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-[(2-methylpropan-2-yl)oxy]-oxophosphanium.
| Compound Name | [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-[(2-methylpropan-2-yl)oxy]-oxophosphanium |
|---|---|
| PubChem CID | 11234580 |
| Molecular Formula | C14H21N5O6P+ |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-[(2-methylpropan-2-yl)oxy]-oxophosphanium |
| SMILES | Cc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](CO[P+](=O)OC(C)(C)C)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H20N5O6P/c1-8-6-19(13(21)16-12(8)20)11-5-9(17-18-15)10(24-11)7-23-26(22)25-14(2,3)4/h6,9-11H,5,7H2,1-4H3/p+1/t9-,10+,11+/m0/s1 |
| InChIKey | ZOAQMUWYNGMXGA-HBNTYKKESA-O |
| XLogP | 2.30 |
| TPSA | 148.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|