C29H37F3N2O6Si — CID 139611776
3-benzoyl-1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(4-methylpent-2-ynoxy)oxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 139611776) has the molecular formula C29H37F3N2O6Si and a molecular weight of 594.70 g/mol. Its IUPAC name is 3-benzoyl-1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(4-methylpent-2-ynoxy)oxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 3-benzoyl-1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(4-methylpent-2-ynoxy)oxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139611776 |
| Molecular Formula | C29H37F3N2O6Si |
| Molecular Weight | 594.70 g/mol |
| Exact Mass | 594.24 |
| IUPAC Name | 3-benzoyl-1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(4-methylpent-2-ynoxy)oxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | CC(C)C#CCO[C@H]1C[C@H](n2cc(C(F)(F)F)c(=O)n(C(=O)c3ccccc3)c2=O)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H37F3N2O6Si/c1-19(2)12-11-15-38-22-16-24(40-23(22)18-39-41(6,7)28(3,4)5)33-17-21(29(30,31)32)26(36)34(27(33)37)25(35)20-13-9-8-10-14-20/h8-10,13-14,17,19,22-24H,15-16,18H2,1-7H3/t22-,23+,24+/m0/s1 |
| InChIKey | GQAHHXHLJGXSOM-RBZQAINGSA-N |
| XLogP | 5.07 |
| TPSA | 88.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.70 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|