C25H27F3N2O7 — CID 139643410
3-benzoyl-1-[(2R,4S,5R)-5-(1-propoxyethoxymethyl)-4-prop-2-ynoxyoxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 139643410) has the molecular formula C25H27F3N2O7 and a molecular weight of 524.49 g/mol. Its IUPAC name is 3-benzoyl-1-[(2R,4S,5R)-5-(1-propoxyethoxymethyl)-4-prop-2-ynoxyoxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 3-benzoyl-1-[(2R,4S,5R)-5-(1-propoxyethoxymethyl)-4-prop-2-ynoxyoxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139643410 |
| Molecular Formula | C25H27F3N2O7 |
| Molecular Weight | 524.49 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 3-benzoyl-1-[(2R,4S,5R)-5-(1-propoxyethoxymethyl)-4-prop-2-ynoxyoxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | C#CCO[C@H]1C[C@H](n2cc(C(F)(F)F)c(=O)n(C(=O)c3ccccc3)c2=O)O[C@@H]1COC(C)OCCC |
| InChI | InChI=1S/C25H27F3N2O7/c1-4-11-34-16(3)36-15-20-19(35-12-5-2)13-21(37-20)29-14-18(25(26,27)28)23(32)30(24(29)33)22(31)17-9-7-6-8-10-17/h2,6-10,14,16,19-21H,4,11-13,15H2,1,3H3/t16?,19-,20+,21+/m0/s1 |
| InChIKey | ATURNWFYPJRONC-FYBUIRDTSA-N |
| XLogP | 2.81 |
| TPSA | 97.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|