C21H29F3N2O6Si — CID 139611645
3-acetyl-1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-2-ynoxyoxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 139611645) has the molecular formula C21H29F3N2O6Si and a molecular weight of 490.55 g/mol. Its IUPAC name is 3-acetyl-1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-2-ynoxyoxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 3-acetyl-1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-2-ynoxyoxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139611645 |
| Molecular Formula | C21H29F3N2O6Si |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 3-acetyl-1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-2-ynoxyoxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | C#CCO[C@H]1C[C@H](n2cc(C(F)(F)F)c(=O)n(C(C)=O)c2=O)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H29F3N2O6Si/c1-8-9-30-15-10-17(32-16(15)12-31-33(6,7)20(3,4)5)25-11-14(21(22,23)24)18(28)26(13(2)27)19(25)29/h1,11,15-17H,9-10,12H2,2-7H3/t15-,16+,17+/m0/s1 |
| InChIKey | DTCVIUYMKDWXLX-GVDBMIGSSA-N |
| XLogP | 3.02 |
| TPSA | 88.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|