C24H25F3N2O8 — CID 139643401
3-benzoyl-1-[(2R,4S,5R)-5-(2-methoxyethoxymethoxymethyl)-4-prop-2-ynoxyoxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 139643401) has the molecular formula C24H25F3N2O8 and a molecular weight of 526.46 g/mol. Its IUPAC name is 3-benzoyl-1-[(2R,4S,5R)-5-(2-methoxyethoxymethoxymethyl)-4-prop-2-ynoxyoxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 3-benzoyl-1-[(2R,4S,5R)-5-(2-methoxyethoxymethoxymethyl)-4-prop-2-ynoxyoxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139643401 |
| Molecular Formula | C24H25F3N2O8 |
| Molecular Weight | 526.46 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | 3-benzoyl-1-[(2R,4S,5R)-5-(2-methoxyethoxymethoxymethyl)-4-prop-2-ynoxyoxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | C#CCO[C@H]1C[C@H](n2cc(C(F)(F)F)c(=O)n(C(=O)c3ccccc3)c2=O)O[C@@H]1COCOCCOC |
| InChI | InChI=1S/C24H25F3N2O8/c1-3-9-36-18-12-20(37-19(18)14-35-15-34-11-10-33-2)28-13-17(24(25,26)27)22(31)29(23(28)32)21(30)16-7-5-4-6-8-16/h1,4-8,13,18-20H,9-12,14-15H2,2H3/t18-,19+,20+/m0/s1 |
| InChIKey | UQEXEYUIWKLAAV-XUVXKRRUSA-N |
| XLogP | 1.66 |
| TPSA | 107.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|