C26H38N2O6S2Si — CID 59718461
3-benzoyl-1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[2-(ethyldisulfanyl)ethoxy]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 59718461) has the molecular formula C26H38N2O6S2Si and a molecular weight of 566.82 g/mol. Its IUPAC name is 3-benzoyl-1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[2-(ethyldisulfanyl)ethoxy]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 3-benzoyl-1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[2-(ethyldisulfanyl)ethoxy]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 59718461 |
| Molecular Formula | C26H38N2O6S2Si |
| Molecular Weight | 566.82 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | 3-benzoyl-1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[2-(ethyldisulfanyl)ethoxy]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CCSSCCO[C@H]1C[C@H](n2ccc(=O)n(C(=O)c3ccccc3)c2=O)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H38N2O6S2Si/c1-7-35-36-16-15-32-20-17-23(34-21(20)18-33-37(5,6)26(2,3)4)27-14-13-22(29)28(25(27)31)24(30)19-11-9-8-10-12-19/h8-14,20-21,23H,7,15-18H2,1-6H3/t20-,21+,23+/m0/s1 |
| InChIKey | KKDRAQABTYPNMC-QZNHQXDQSA-N |
| XLogP | 4.79 |
| TPSA | 88.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.82 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|