C30H31N5O5 — CID 73164032
1-[4-azido-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-5-methyl-1,3-diazinane-2,4-dione (PubChem CID 73164032) has the molecular formula C30H31N5O5 and a molecular weight of 541.61 g/mol. Its IUPAC name is 1-[4-azido-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-5-methyl-1,3-diazinane-2,4-dione.
| Compound Name | 1-[4-azido-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-5-methyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 73164032 |
| Molecular Formula | C30H31N5O5 |
| Molecular Weight | 541.61 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | 1-[4-azido-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-5-methyl-1,3-diazinane-2,4-dione |
| SMILES | COc1ccc(C(OCC2OC(N3CC(C)C(=O)NC3=O)CC2N=[N+]=[N-])(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H31N5O5/c1-20-18-35(29(37)32-28(20)36)27-17-25(33-34-31)26(40-27)19-39-30(21-9-5-3-6-10-21,22-11-7-4-8-12-22)23-13-15-24(38-2)16-14-23/h3-16,20,25-27H,17-19H2,1-2H3,(H,32,36,37) |
| InChIKey | DGKAQXVQSFSWOT-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 125.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|