C40H47N3O6S2 — CID 87525902
N-[6-[4-hydroxy-2-[(4-methoxyphenyl)-[(4-methoxyphenyl)methoxy]-phenylmethyl]pyrrolidin-1-yl]-6-oxohexyl]-3-(pyridin-2-yldisulfanyl)propanamide (PubChem CID 87525902) has the molecular formula C40H47N3O6S2 and a molecular weight of 729.97 g/mol. Its IUPAC name is N-[6-[4-hydroxy-2-[(4-methoxyphenyl)-[(4-methoxyphenyl)methoxy]-phenylmethyl]pyrrolidin-1-yl]-6-oxohexyl]-3-(pyridin-2-yldisulfanyl)propanamide.
| Compound Name | N-[6-[4-hydroxy-2-[(4-methoxyphenyl)-[(4-methoxyphenyl)methoxy]-phenylmethyl]pyrrolidin-1-yl]-6-oxohexyl]-3-(pyridin-2-yldisulfanyl)propanamide |
|---|---|
| PubChem CID | 87525902 |
| Molecular Formula | C40H47N3O6S2 |
| Molecular Weight | 729.97 g/mol |
| Exact Mass | 729.29 |
| IUPAC Name | N-[6-[4-hydroxy-2-[(4-methoxyphenyl)-[(4-methoxyphenyl)methoxy]-phenylmethyl]pyrrolidin-1-yl]-6-oxohexyl]-3-(pyridin-2-yldisulfanyl)propanamide |
| SMILES | COc1ccc(COC(c2ccccc2)(c2ccc(OC)cc2)C2CC(O)CN2C(=O)CCCCCNC(=O)CCSSc2ccccn2)cc1 |
| InChI | InChI=1S/C40H47N3O6S2/c1-47-34-19-15-30(16-20-34)29-49-40(31-11-5-3-6-12-31,32-17-21-35(48-2)22-18-32)36-27-33(44)28-43(36)39(46)14-7-4-9-24-41-37(45)23-26-50-51-38-13-8-10-25-42-38/h3,5-6,8,10-13,15-22,25,33,36,44H,4,7,9,14,23-24,26-29H2,1-2H3,(H,41,45) |
| InChIKey | RWUNKJYXZDAPKJ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.97 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|