C33H40N2O7 — CID 176637690
[6-[4-hydroxy-2-[(4-methoxyphenyl)-[(4-methoxyphenyl)methoxy]-phenylmethyl]pyrrolidin-1-yl]-6-oxohexyl]carbamic acid (PubChem CID 176637690) has the molecular formula C33H40N2O7 and a molecular weight of 576.69 g/mol. Its IUPAC name is [6-[4-hydroxy-2-[(4-methoxyphenyl)-[(4-methoxyphenyl)methoxy]-phenylmethyl]pyrrolidin-1-yl]-6-oxohexyl]carbamic acid.
| Compound Name | [6-[4-hydroxy-2-[(4-methoxyphenyl)-[(4-methoxyphenyl)methoxy]-phenylmethyl]pyrrolidin-1-yl]-6-oxohexyl]carbamic acid |
|---|---|
| PubChem CID | 176637690 |
| Molecular Formula | C33H40N2O7 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.28 |
| IUPAC Name | [6-[4-hydroxy-2-[(4-methoxyphenyl)-[(4-methoxyphenyl)methoxy]-phenylmethyl]pyrrolidin-1-yl]-6-oxohexyl]carbamic acid |
| SMILES | COc1ccc(COC(c2ccccc2)(c2ccc(OC)cc2)C2CC(O)CN2C(=O)CCCCCNC(=O)O)cc1 |
| InChI | InChI=1S/C33H40N2O7/c1-40-28-16-12-24(13-17-28)23-42-33(25-9-5-3-6-10-25,26-14-18-29(41-2)19-15-26)30-21-27(36)22-35(30)31(37)11-7-4-8-20-34-32(38)39/h3,5-6,9-10,12-19,27,30,34,36H,4,7-8,11,20-23H2,1-2H3,(H,38,39) |
| InChIKey | YCACQHSXAMRBJP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|