C44H53N3O7 — CID 118248995
N-[(5S)-6-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]-5-(hex-5-ynoylamino)-6-oxohexyl]hex-5-ynamide (PubChem CID 118248995) has the molecular formula C44H53N3O7 and a molecular weight of 735.92 g/mol. Its IUPAC name is N-[(5S)-6-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]-5-(hex-5-ynoylamino)-6-oxohexyl]hex-5-ynamide.
| Compound Name | N-[(5S)-6-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]-5-(hex-5-ynoylamino)-6-oxohexyl]hex-5-ynamide |
|---|---|
| PubChem CID | 118248995 |
| Molecular Formula | C44H53N3O7 |
| Molecular Weight | 735.92 g/mol |
| Exact Mass | 735.39 |
| IUPAC Name | N-[(5S)-6-[(2S,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxypyrrolidin-1-yl]-5-(hex-5-ynoylamino)-6-oxohexyl]hex-5-ynamide |
| SMILES | C#CCCCC(=O)NCCCC[C@H](NC(=O)CCCC#C)C(=O)N1C[C@H](O)C[C@H]1COC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C44H53N3O7/c1-5-7-10-19-41(49)45-29-15-14-18-40(46-42(50)20-11-8-6-2)43(51)47-31-37(48)30-36(47)32-54-44(33-16-12-9-13-17-33,34-21-25-38(52-3)26-22-34)35-23-27-39(53-4)28-24-35/h1-2,9,12-13,16-17,21-28,36-37,40,48H,7-8,10-11,14-15,18-20,29-32H2,3-4H3,(H,45,49)(H,46,50)/t36-,37+,40-/m0/s1 |
| InChIKey | GJVVHHULIUUUFW-AFYOCNOBSA-N |
| XLogP | 5.35 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.92 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|