C33H42N2O6 — CID 154408622
6-[2-[bis(4-methoxyphenyl)methoxy-phenylmethyl]-4-hydroxypyrrolidin-1-yl]hexylcarbamic acid (PubChem CID 154408622) has the molecular formula C33H42N2O6 and a molecular weight of 562.71 g/mol. Its IUPAC name is 6-[2-[bis(4-methoxyphenyl)methoxy-phenylmethyl]-4-hydroxypyrrolidin-1-yl]hexylcarbamic acid.
| Compound Name | 6-[2-[bis(4-methoxyphenyl)methoxy-phenylmethyl]-4-hydroxypyrrolidin-1-yl]hexylcarbamic acid |
|---|---|
| PubChem CID | 154408622 |
| Molecular Formula | C33H42N2O6 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.30 |
| IUPAC Name | 6-[2-[bis(4-methoxyphenyl)methoxy-phenylmethyl]-4-hydroxypyrrolidin-1-yl]hexylcarbamic acid |
| SMILES | COc1ccc(C(OC(c2ccccc2)C2CC(O)CN2CCCCCCNC(=O)O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C33H42N2O6/c1-39-28-16-12-25(13-17-28)31(26-14-18-29(40-2)19-15-26)41-32(24-10-6-5-7-11-24)30-22-27(36)23-35(30)21-9-4-3-8-20-34-33(37)38/h5-7,10-19,27,30-32,34,36H,3-4,8-9,20-23H2,1-2H3,(H,37,38) |
| InChIKey | GYSKOGGEAJERCL-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|