C16H24N2O2 — CID 57440411
ethyl 4-(3,4,5-trimethylpiperazin-1-yl)benzoate (PubChem CID 57440411) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is ethyl 4-(3,4,5-trimethylpiperazin-1-yl)benzoate.
| Compound Name | ethyl 4-(3,4,5-trimethylpiperazin-1-yl)benzoate |
|---|---|
| PubChem CID | 57440411 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | ethyl 4-(3,4,5-trimethylpiperazin-1-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(N2CC(C)N(C)C(C)C2)cc1 |
| InChI | InChI=1S/C16H24N2O2/c1-5-20-16(19)14-6-8-15(9-7-14)18-10-12(2)17(4)13(3)11-18/h6-9,12-13H,5,10-11H2,1-4H3 |
| InChIKey | FFRKYQXPGWEEMW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |