C19H24N4O2 — CID 54167175
ethyl 4-[(3S,5R)-3,5-dimethyl-4-pyrimidin-2-ylpiperazin-1-yl]benzoate (PubChem CID 54167175) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is ethyl 4-[(3S,5R)-3,5-dimethyl-4-pyrimidin-2-ylpiperazin-1-yl]benzoate.
| Compound Name | ethyl 4-[(3S,5R)-3,5-dimethyl-4-pyrimidin-2-ylpiperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 54167175 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | ethyl 4-[(3S,5R)-3,5-dimethyl-4-pyrimidin-2-ylpiperazin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C[C@@H](C)N(c3ncccn3)[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C19H24N4O2/c1-4-25-18(24)16-6-8-17(9-7-16)22-12-14(2)23(15(3)13-22)19-20-10-5-11-21-19/h5-11,14-15H,4,12-13H2,1-3H3/t14-,15+ |
| InChIKey | OSLXXHKNBNEKOT-GASCZTMLSA-N |
| XLogP | 2.76 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |