C16H25N3O2 — CID 114539655
ethyl 2-amino-3-(3,4,5-trimethylpiperazin-1-yl)benzoate (PubChem CID 114539655) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is ethyl 2-amino-3-(3,4,5-trimethylpiperazin-1-yl)benzoate.
| Compound Name | ethyl 2-amino-3-(3,4,5-trimethylpiperazin-1-yl)benzoate |
|---|---|
| PubChem CID | 114539655 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | ethyl 2-amino-3-(3,4,5-trimethylpiperazin-1-yl)benzoate |
| SMILES | CCOC(=O)c1cccc(N2CC(C)N(C)C(C)C2)c1N |
| InChI | InChI=1S/C16H25N3O2/c1-5-21-16(20)13-7-6-8-14(15(13)17)19-9-11(2)18(4)12(3)10-19/h6-8,11-12H,5,9-10,17H2,1-4H3 |
| InChIKey | DOLGCQZQPPOIAS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|