C16H24N2O3 — CID 115545734
ethyl 2-amino-3-(2,2,6-trimethylmorpholin-4-yl)benzoate (PubChem CID 115545734) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is ethyl 2-amino-3-(2,2,6-trimethylmorpholin-4-yl)benzoate.
| Compound Name | ethyl 2-amino-3-(2,2,6-trimethylmorpholin-4-yl)benzoate |
|---|---|
| PubChem CID | 115545734 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | ethyl 2-amino-3-(2,2,6-trimethylmorpholin-4-yl)benzoate |
| SMILES | CCOC(=O)c1cccc(N2CC(C)OC(C)(C)C2)c1N |
| InChI | InChI=1S/C16H24N2O3/c1-5-20-15(19)12-7-6-8-13(14(12)17)18-9-11(2)21-16(3,4)10-18/h6-8,11H,5,9-10,17H2,1-4H3 |
| InChIKey | UTWCZOMBYCBBPE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|