C17H16N2O2S — CID 100936892
[(4R,5R)-4,5-diphenyl-2-sulfanylideneimidazolidin-1-yl] acetate (PubChem CID 100936892) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is [(4R,5R)-4,5-diphenyl-2-sulfanylideneimidazolidin-1-yl] acetate.
| Compound Name | [(4R,5R)-4,5-diphenyl-2-sulfanylideneimidazolidin-1-yl] acetate |
|---|---|
| PubChem CID | 100936892 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | [(4R,5R)-4,5-diphenyl-2-sulfanylideneimidazolidin-1-yl] acetate |
| SMILES | CC(=O)ON1C(=S)N[C@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H16N2O2S/c1-12(20)21-19-16(14-10-6-3-7-11-14)15(18-17(19)22)13-8-4-2-5-9-13/h2-11,15-16H,1H3,(H,18,22)/t15-,16-/m1/s1 |
| InChIKey | WTJYCCLAJGSLPU-HZPDHXFCSA-N |
| XLogP | 3.14 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|